C26H28F3N3O2 — CID 90097875
3-[difluoro-(2-fluoro-4-methylphenyl)methoxy]-6-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]pyridazine (PubChem CID 90097875) has the molecular formula C26H28F3N3O2 and a molecular weight of 471.52 g/mol. Its IUPAC name is 3-[difluoro-(2-fluoro-4-methylphenyl)methoxy]-6-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]pyridazine.
| Compound Name | 3-[difluoro-(2-fluoro-4-methylphenyl)methoxy]-6-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]pyridazine |
|---|---|
| PubChem CID | 90097875 |
| Molecular Formula | C26H28F3N3O2 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 3-[difluoro-(2-fluoro-4-methylphenyl)methoxy]-6-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]pyridazine |
| SMILES | Cc1ccc(C(F)(F)Oc2ccc(-c3ccc(OCCCN4CCCC4C)cc3)nn2)c(F)c1 |
| InChI | InChI=1S/C26H28F3N3O2/c1-18-6-11-22(23(27)17-18)26(28,29)34-25-13-12-24(30-31-25)20-7-9-21(10-8-20)33-16-4-15-32-14-3-5-19(32)2/h6-13,17,19H,3-5,14-16H2,1-2H3 |
| InChIKey | FZRRNOBJMGZYRU-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|