C22H25N3OS — CID 66630475
3-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-6-thiophen-2-ylpyridazine (PubChem CID 66630475) has the molecular formula C22H25N3OS and a molecular weight of 379.53 g/mol. Its IUPAC name is 3-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-6-thiophen-2-ylpyridazine.
| Compound Name | 3-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-6-thiophen-2-ylpyridazine |
|---|---|
| PubChem CID | 66630475 |
| Molecular Formula | C22H25N3OS |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 3-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-6-thiophen-2-ylpyridazine |
| SMILES | CC1CCCN1CCCOc1ccc(-c2ccc(-c3cccs3)nn2)cc1 |
| InChI | InChI=1S/C22H25N3OS/c1-17-5-2-13-25(17)14-4-15-26-19-9-7-18(8-10-19)20-11-12-21(24-23-20)22-6-3-16-27-22/h3,6-12,16-17H,2,4-5,13-15H2,1H3 |
| InChIKey | AWWYLUCTZLYBTG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|