C26H27F4N5O4 — CID 90098153
tert-butyl N-[(3R,6R)-2-[5-[(5-cyano-3-methylpyridine-2-carbonyl)amino]-2-fluorophenyl]-3,6-dimethyl-6-(trifluoromethyl)-2,3-dihydro-1,4-oxazin-5-yl]carbamate (PubChem CID 90098153) has the molecular formula C26H27F4N5O4 and a molecular weight of 549.53 g/mol. Its IUPAC name is tert-butyl N-[(3R,6R)-2-[5-[(5-cyano-3-methylpyridine-2-carbonyl)amino]-2-fluorophenyl]-3,6-dimethyl-6-(trifluoromethyl)-2,3-dihydro-1,4-oxazin-5-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,6R)-2-[5-[(5-cyano-3-methylpyridine-2-carbonyl)amino]-2-fluorophenyl]-3,6-dimethyl-6-(trifluoromethyl)-2,3-dihydro-1,4-oxazin-5-yl]carbamate |
|---|---|
| PubChem CID | 90098153 |
| Molecular Formula | C26H27F4N5O4 |
| Molecular Weight | 549.53 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | tert-butyl N-[(3R,6R)-2-[5-[(5-cyano-3-methylpyridine-2-carbonyl)amino]-2-fluorophenyl]-3,6-dimethyl-6-(trifluoromethyl)-2,3-dihydro-1,4-oxazin-5-yl]carbamate |
| SMILES | Cc1cc(C#N)cnc1C(=O)Nc1ccc(F)c(C2O[C@@](C)(C(F)(F)F)C(NC(=O)OC(C)(C)C)=N[C@@H]2C)c1 |
| InChI | InChI=1S/C26H27F4N5O4/c1-13-9-15(11-31)12-32-19(13)21(36)34-16-7-8-18(27)17(10-16)20-14(2)33-22(25(6,38-20)26(28,29)30)35-23(37)39-24(3,4)5/h7-10,12,14,20H,1-6H3,(H,34,36)(H,33,35,37)/t14-,20?,25-/m1/s1 |
| InChIKey | QNRWICXAXFFGTR-GKNJHEJMSA-N |
| XLogP | 5.36 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |