C11H10BrF3O5 — CID 90098604
ethyl 3-(5-bromo-2-fluorophenyl)-2,2-difluoro-3-(trioxidanyl)propanoate (PubChem CID 90098604) has the molecular formula C11H10BrF3O5 and a molecular weight of 359.09 g/mol. Its IUPAC name is ethyl 3-(5-bromo-2-fluorophenyl)-2,2-difluoro-3-(trioxidanyl)propanoate.
| Compound Name | ethyl 3-(5-bromo-2-fluorophenyl)-2,2-difluoro-3-(trioxidanyl)propanoate |
|---|---|
| PubChem CID | 90098604 |
| Molecular Formula | C11H10BrF3O5 |
| Molecular Weight | 359.09 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | ethyl 3-(5-bromo-2-fluorophenyl)-2,2-difluoro-3-(trioxidanyl)propanoate |
| SMILES | CCOC(=O)C(F)(F)C(OOO)c1cc(Br)ccc1F |
| InChI | InChI=1S/C11H10BrF3O5/c1-2-18-10(16)11(14,15)9(19-20-17)7-5-6(12)3-4-8(7)13/h3-5,9,17H,2H2,1H3 |
| InChIKey | LPSVLOXGTGMHQZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.09 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|