C15H14F6N2O3 — CID 90105368
N-(3-formyl-2-methylphenyl)-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)azetidine-1-carboxamide (PubChem CID 90105368) has the molecular formula C15H14F6N2O3 and a molecular weight of 384.28 g/mol. Its IUPAC name is N-(3-formyl-2-methylphenyl)-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)azetidine-1-carboxamide.
| Compound Name | N-(3-formyl-2-methylphenyl)-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 90105368 |
| Molecular Formula | C15H14F6N2O3 |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | N-(3-formyl-2-methylphenyl)-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)azetidine-1-carboxamide |
| SMILES | Cc1c(C=O)cccc1NC(=O)N1CC(OC(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C15H14F6N2O3/c1-8-9(7-24)3-2-4-11(8)22-13(25)23-5-10(6-23)26-12(14(16,17)18)15(19,20)21/h2-4,7,10,12H,5-6H2,1H3,(H,22,25) |
| InChIKey | YDWYZJUVTJONMS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|