C21H25N3O5 — CID 9010875
(5-phenyl-1,3-oxazol-2-yl)methyl 2-[(4S)-4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 9010875) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is (5-phenyl-1,3-oxazol-2-yl)methyl 2-[(4S)-4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | (5-phenyl-1,3-oxazol-2-yl)methyl 2-[(4S)-4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 9010875 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | (5-phenyl-1,3-oxazol-2-yl)methyl 2-[(4S)-4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | CC(C)CC[C@]1(C)NC(=O)N(CC(=O)OCc2ncc(-c3ccccc3)o2)C1=O |
| InChI | InChI=1S/C21H25N3O5/c1-14(2)9-10-21(3)19(26)24(20(27)23-21)12-18(25)28-13-17-22-11-16(29-17)15-7-5-4-6-8-15/h4-8,11,14H,9-10,12-13H2,1-3H3,(H,23,27)/t21-/m0/s1 |
| InChIKey | OWJOJJUWLDYPSS-NRFANRHFSA-N |
| XLogP | 3.13 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|