C25H21F3N2O5 — CID 90110497
2-[5-[2-[[benzoyloxycarbonyl(ethyl)amino]methyl]-4-(trifluoromethyl)phenyl]-3-pyridinyl]acetic acid (PubChem CID 90110497) has the molecular formula C25H21F3N2O5 and a molecular weight of 486.45 g/mol. Its IUPAC name is 2-[5-[2-[[benzoyloxycarbonyl(ethyl)amino]methyl]-4-(trifluoromethyl)phenyl]-3-pyridinyl]acetic acid.
| Compound Name | 2-[5-[2-[[benzoyloxycarbonyl(ethyl)amino]methyl]-4-(trifluoromethyl)phenyl]-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 90110497 |
| Molecular Formula | C25H21F3N2O5 |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 2-[5-[2-[[benzoyloxycarbonyl(ethyl)amino]methyl]-4-(trifluoromethyl)phenyl]-3-pyridinyl]acetic acid |
| SMILES | CCN(Cc1cc(C(F)(F)F)ccc1-c1cncc(CC(=O)O)c1)C(=O)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H21F3N2O5/c1-2-30(24(34)35-23(33)17-6-4-3-5-7-17)15-19-12-20(25(26,27)28)8-9-21(19)18-10-16(11-22(31)32)13-29-14-18/h3-10,12-14H,2,11,15H2,1H3,(H,31,32) |
| InChIKey | CAPVVHUVLHGZST-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|