About 5-butoxyperoxydecane
5-butoxyperoxydecane (PubChem CID 90111199) has the molecular formula C14H30O3
and a molecular weight of 246.39 g/mol. Its IUPAC name is 5-butoxyperoxydecane.
Molecular Properties
| Compound Name | 5-butoxyperoxydecane |
| PubChem CID | 90111199 |
| Molecular Formula | C14H30O3 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.22 |
| IUPAC Name | 5-butoxyperoxydecane |
| SMILES | CCCCCC(CCCC)OOOCCCC |
| InChI | InChI=1S/C14H30O3/c1-4-7-10-12-14(11-8-5-2)16-17-15-13-9-6-3/h14H,4-13H2,1-3H3 |
| InChIKey | GXCWEPZWPNCRPX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 5-butoxyperoxydecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butoxyperoxydecane?
The IUPAC name of 5-butoxyperoxydecane (CID 90111199) is 5-butoxyperoxydecane.
What is the SMILES notation for 5-butoxyperoxydecane?
The canonical SMILES for 5-butoxyperoxydecane is CCCCCC(CCCC)OOOCCCC.
What is the InChIKey of 5-butoxyperoxydecane?
The InChIKey is GXCWEPZWPNCRPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O3/c1-4-7-10-12-14(11-8-5-2)16-17-15-13-9-6-3/h14H,4-13H2,1-3H3.
What are the key properties of 5-butoxyperoxydecane?
5-butoxyperoxydecane has a molecular weight of 246.39 g/mol, XLogP of 4.81, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butoxyperoxydecane is sourced from PubChem (CID 90111199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).