C31H34ClNO4 — CID 90112830
dipropan-2-yl 2-[[4-[[6-(3-chlorophenyl)-2,3-dihydro-1H-inden-4-yl]amino]phenyl]methyl]propanedioate (PubChem CID 90112830) has the molecular formula C31H34ClNO4 and a molecular weight of 520.07 g/mol. Its IUPAC name is dipropan-2-yl 2-[[4-[[6-(3-chlorophenyl)-2,3-dihydro-1H-inden-4-yl]amino]phenyl]methyl]propanedioate.
| Compound Name | dipropan-2-yl 2-[[4-[[6-(3-chlorophenyl)-2,3-dihydro-1H-inden-4-yl]amino]phenyl]methyl]propanedioate |
|---|---|
| PubChem CID | 90112830 |
| Molecular Formula | C31H34ClNO4 |
| Molecular Weight | 520.07 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | dipropan-2-yl 2-[[4-[[6-(3-chlorophenyl)-2,3-dihydro-1H-inden-4-yl]amino]phenyl]methyl]propanedioate |
| SMILES | CC(C)OC(=O)C(Cc1ccc(Nc2cc(-c3cccc(Cl)c3)cc3c2CCC3)cc1)C(=O)OC(C)C |
| InChI | InChI=1S/C31H34ClNO4/c1-19(2)36-30(34)28(31(35)37-20(3)4)15-21-11-13-26(14-12-21)33-29-18-24(16-23-8-6-10-27(23)29)22-7-5-9-25(32)17-22/h5,7,9,11-14,16-20,28,33H,6,8,10,15H2,1-4H3 |
| InChIKey | ABBCLMSBGVTSNI-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.07 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|