C21H15F8N3O4 — CID 90115516
[3-[[8-[(2,6-difluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carbonyl]amino]-1,1,1-trifluoropropan-2-yl] 2,2,2-trifluoroacetate (PubChem CID 90115516) has the molecular formula C21H15F8N3O4 and a molecular weight of 525.35 g/mol. Its IUPAC name is [3-[[8-[(2,6-difluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carbonyl]amino]-1,1,1-trifluoropropan-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [3-[[8-[(2,6-difluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carbonyl]amino]-1,1,1-trifluoropropan-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 90115516 |
| Molecular Formula | C21H15F8N3O4 |
| Molecular Weight | 525.35 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | [3-[[8-[(2,6-difluorophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine-3-carbonyl]amino]-1,1,1-trifluoropropan-2-yl] 2,2,2-trifluoroacetate |
| SMILES | Cc1nc2c(OCc3c(F)cccc3F)cccn2c1C(=O)NCC(OC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H15F8N3O4/c1-10-16(18(33)30-8-15(20(24,25)26)36-19(34)21(27,28)29)32-7-3-6-14(17(32)31-10)35-9-11-12(22)4-2-5-13(11)23/h2-7,15H,8-9H2,1H3,(H,30,33) |
| InChIKey | CLEFIWWZONBZDB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |