C21H25N5O5S — CID 90115817
(2R)-4-[4-[4-(3,5-dimethyl-1,2,4-triazol-1-yl)phenyl]-2-oxo-1-pyridinyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 90115817) has the molecular formula C21H25N5O5S and a molecular weight of 459.53 g/mol. Its IUPAC name is (2R)-4-[4-[4-(3,5-dimethyl-1,2,4-triazol-1-yl)phenyl]-2-oxo-1-pyridinyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | (2R)-4-[4-[4-(3,5-dimethyl-1,2,4-triazol-1-yl)phenyl]-2-oxo-1-pyridinyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 90115817 |
| Molecular Formula | C21H25N5O5S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | (2R)-4-[4-[4-(3,5-dimethyl-1,2,4-triazol-1-yl)phenyl]-2-oxo-1-pyridinyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | Cc1nc(C)n(-c2ccc(-c3ccn(CC[C@](C)(C(=O)NO)S(C)(=O)=O)c(=O)c3)cc2)n1 |
| InChI | InChI=1S/C21H25N5O5S/c1-14-22-15(2)26(23-14)18-7-5-16(6-8-18)17-9-11-25(19(27)13-17)12-10-21(3,20(28)24-29)32(4,30)31/h5-9,11,13,29H,10,12H2,1-4H3,(H,24,28)/t21-/m1/s1 |
| InChIKey | GCYICAKSLJEQOF-OAQYLSRUSA-N |
| XLogP | 1.41 |
| TPSA | 136.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|