C20H27N3O7S2 — CID 90115864
4-[4-[5-(dimethylsulfamoyl)-2-methylphenyl]-2-oxo-1-pyridinyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 90115864) has the molecular formula C20H27N3O7S2 and a molecular weight of 485.58 g/mol. Its IUPAC name is 4-[4-[5-(dimethylsulfamoyl)-2-methylphenyl]-2-oxo-1-pyridinyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | 4-[4-[5-(dimethylsulfamoyl)-2-methylphenyl]-2-oxo-1-pyridinyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 90115864 |
| Molecular Formula | C20H27N3O7S2 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 4-[4-[5-(dimethylsulfamoyl)-2-methylphenyl]-2-oxo-1-pyridinyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C)cc1-c1ccn(CCC(C)(C(=O)NO)S(C)(=O)=O)c(=O)c1 |
| InChI | InChI=1S/C20H27N3O7S2/c1-14-6-7-16(32(29,30)22(3)4)13-17(14)15-8-10-23(18(24)12-15)11-9-20(2,19(25)21-26)31(5,27)28/h6-8,10,12-13,26H,9,11H2,1-5H3,(H,21,25) |
| InChIKey | KVCYFKYHYRXHMK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 142.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|