C11H17N3O7 — CID 90116262
6-[[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethylamino]-1H-pyrimidin-2-one (PubChem CID 90116262) has the molecular formula C11H17N3O7 and a molecular weight of 303.27 g/mol. Its IUPAC name is 6-[[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethylamino]-1H-pyrimidin-2-one.
| Compound Name | 6-[[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethylamino]-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 90116262 |
| Molecular Formula | C11H17N3O7 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 6-[[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethylamino]-1H-pyrimidin-2-one |
| SMILES | O=c1nccc(NCOC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[nH]1 |
| InChI | InChI=1S/C11H17N3O7/c15-3-5-7(16)8(17)9(18)10(21-5)20-4-13-6-1-2-12-11(19)14-6/h1-2,5,7-10,15-18H,3-4H2,(H2,12,13,14,19)/t5-,7-,8+,9-,10?/m1/s1 |
| InChIKey | CRAZEABCJXFOFR-QNRYFBKSSA-N |
| XLogP | -3.04 |
| TPSA | 157.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|