C10H13FN2O7 — CID 57054689
5-fluoro-6-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-pyrimidin-2-one (PubChem CID 57054689) has the molecular formula C10H13FN2O7 and a molecular weight of 292.22 g/mol. Its IUPAC name is 5-fluoro-6-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-pyrimidin-2-one.
| Compound Name | 5-fluoro-6-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 57054689 |
| Molecular Formula | C10H13FN2O7 |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 5-fluoro-6-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-pyrimidin-2-one |
| SMILES | O=c1ncc(F)c(O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[nH]1 |
| InChI | InChI=1S/C10H13FN2O7/c11-3-1-12-10(18)13-8(3)20-9-7(17)6(16)5(15)4(2-14)19-9/h1,4-7,9,14-17H,2H2,(H,12,13,18)/t4-,5+,6+,7-,9+/m1/s1 |
| InChIKey | SHFFGVADGARXCS-RZTSUAATSA-N |
| XLogP | -2.91 |
| TPSA | 145.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |