C17H19FN2O7 — CID 54167924
1-benzyl-5-fluoro-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypyrimidin-2-one (PubChem CID 54167924) has the molecular formula C17H19FN2O7 and a molecular weight of 382.34 g/mol. Its IUPAC name is 1-benzyl-5-fluoro-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypyrimidin-2-one.
| Compound Name | 1-benzyl-5-fluoro-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypyrimidin-2-one |
|---|---|
| PubChem CID | 54167924 |
| Molecular Formula | C17H19FN2O7 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 1-benzyl-5-fluoro-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypyrimidin-2-one |
| SMILES | O=c1nc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(F)cn1Cc1ccccc1 |
| InChI | InChI=1S/C17H19FN2O7/c18-10-7-20(6-9-4-2-1-3-5-9)17(25)19-15(10)27-16-14(24)13(23)12(22)11(8-21)26-16/h1-5,7,11-14,16,21-24H,6,8H2/t11-,12-,13+,14-,16+/m1/s1 |
| InChIKey | OSYKALZJTJIBOS-SSZWKKLZSA-N |
| XLogP | -1.39 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |