C11H9F2NO2 — CID 90118253
3,4-difluoro-2,7-dimethoxyquinoline (PubChem CID 90118253) has the molecular formula C11H9F2NO2 and a molecular weight of 225.19 g/mol. Its IUPAC name is 3,4-difluoro-2,7-dimethoxyquinoline.
| Compound Name | 3,4-difluoro-2,7-dimethoxyquinoline |
|---|---|
| PubChem CID | 90118253 |
| Molecular Formula | C11H9F2NO2 |
| Molecular Weight | 225.19 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 3,4-difluoro-2,7-dimethoxyquinoline |
| SMILES | COc1ccc2c(F)c(F)c(OC)nc2c1 |
| InChI | InChI=1S/C11H9F2NO2/c1-15-6-3-4-7-8(5-6)14-11(16-2)10(13)9(7)12/h3-5H,1-2H3 |
| InChIKey | NSSYGVSYGKRNRR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.19 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |