C18H18F3N5O3 — CID 90118476
N-(3-hydroxypropyl)-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]pyrazolo[4,3-c]pyridine-4-carboxamide (PubChem CID 90118476) has the molecular formula C18H18F3N5O3 and a molecular weight of 409.37 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]pyrazolo[4,3-c]pyridine-4-carboxamide.
| Compound Name | N-(3-hydroxypropyl)-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]pyrazolo[4,3-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 90118476 |
| Molecular Formula | C18H18F3N5O3 |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | N-(3-hydroxypropyl)-2-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]pyrazolo[4,3-c]pyridine-4-carboxamide |
| SMILES | O=C(NCCCO)c1nccc2nn(Cc3ccc(OCC(F)(F)F)nc3)cc12 |
| InChI | InChI=1S/C18H18F3N5O3/c19-18(20,21)11-29-15-3-2-12(8-24-15)9-26-10-13-14(25-26)4-6-22-16(13)17(28)23-5-1-7-27/h2-4,6,8,10,27H,1,5,7,9,11H2,(H,23,28) |
| InChIKey | NGSTYUMUHBZSMA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|