C21H24F2N4O3 — CID 90118695
2-[[4-(2,2-difluoropropoxy)-3-methylphenyl]methyl]-N-(3-hydroxypropyl)pyrazolo[4,3-c]pyridine-4-carboxamide (PubChem CID 90118695) has the molecular formula C21H24F2N4O3 and a molecular weight of 418.44 g/mol. Its IUPAC name is 2-[[4-(2,2-difluoropropoxy)-3-methylphenyl]methyl]-N-(3-hydroxypropyl)pyrazolo[4,3-c]pyridine-4-carboxamide.
| Compound Name | 2-[[4-(2,2-difluoropropoxy)-3-methylphenyl]methyl]-N-(3-hydroxypropyl)pyrazolo[4,3-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 90118695 |
| Molecular Formula | C21H24F2N4O3 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 2-[[4-(2,2-difluoropropoxy)-3-methylphenyl]methyl]-N-(3-hydroxypropyl)pyrazolo[4,3-c]pyridine-4-carboxamide |
| SMILES | Cc1cc(Cn2cc3c(C(=O)NCCCO)nccc3n2)ccc1OCC(C)(F)F |
| InChI | InChI=1S/C21H24F2N4O3/c1-14-10-15(4-5-18(14)30-13-21(2,22)23)11-27-12-16-17(26-27)6-8-24-19(16)20(29)25-7-3-9-28/h4-6,8,10,12,28H,3,7,9,11,13H2,1-2H3,(H,25,29) |
| InChIKey | BUMJSIJOTLHHDV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|