About aminomethylcarbamic acid;hydrochloride
aminomethylcarbamic acid;hydrochloride (PubChem CID 90118647) has the molecular formula C2H7ClN2O2
and a molecular weight of 126.54 g/mol. Its IUPAC name is aminomethylcarbamic acid;hydrochloride.
Molecular Properties
| Compound Name | aminomethylcarbamic acid;hydrochloride |
| PubChem CID | 90118647 |
| Molecular Formula | C2H7ClN2O2 |
| Molecular Weight | 126.54 g/mol |
| Exact Mass | 126.02 |
| IUPAC Name | aminomethylcarbamic acid;hydrochloride |
| SMILES | Cl.NCNC(=O)O |
| InChI | InChI=1S/C2H6N2O2.ClH/c3-1-4-2(5)6;/h4H,1,3H2,(H,5,6);1H |
| InChIKey | IIRWASWBWGTZME-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.54 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze aminomethylcarbamic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aminomethylcarbamic acid;hydrochloride?
The IUPAC name of aminomethylcarbamic acid;hydrochloride (CID 90118647) is aminomethylcarbamic acid;hydrochloride.
What is the SMILES notation for aminomethylcarbamic acid;hydrochloride?
The canonical SMILES for aminomethylcarbamic acid;hydrochloride is Cl.NCNC(=O)O.
What is the InChIKey of aminomethylcarbamic acid;hydrochloride?
The InChIKey is IIRWASWBWGTZME-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O2.ClH/c3-1-4-2(5)6;/h4H,1,3H2,(H,5,6);1H.
What are the key properties of aminomethylcarbamic acid;hydrochloride?
aminomethylcarbamic acid;hydrochloride has a molecular weight of 126.54 g/mol, XLogP of -0.41, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for aminomethylcarbamic acid;hydrochloride is sourced from PubChem (CID 90118647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).