C28H43FO3 — CID 90121280
(2Z)-2-[(2E)-2-[1-[(E)-6-ethyl-6-hydroxyoct-4-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-6-fluoro-4-hydroxycyclohexan-1-one (PubChem CID 90121280) has the molecular formula C28H43FO3 and a molecular weight of 446.65 g/mol. Its IUPAC name is (2Z)-2-[(2E)-2-[1-[(E)-6-ethyl-6-hydroxyoct-4-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-6-fluoro-4-hydroxycyclohexan-1-one.
| Compound Name | (2Z)-2-[(2E)-2-[1-[(E)-6-ethyl-6-hydroxyoct-4-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-6-fluoro-4-hydroxycyclohexan-1-one |
|---|---|
| PubChem CID | 90121280 |
| Molecular Formula | C28H43FO3 |
| Molecular Weight | 446.65 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | (2Z)-2-[(2E)-2-[1-[(E)-6-ethyl-6-hydroxyoct-4-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-6-fluoro-4-hydroxycyclohexan-1-one |
| SMILES | CCC(O)(/C=C/CC(C)C1CCC2/C(=C/C=C3/CC(O)CC(F)C3=O)CCCC21C)CC |
| InChI | InChI=1S/C28H43FO3/c1-5-28(32,6-2)16-7-9-19(3)23-13-14-24-20(10-8-15-27(23,24)4)11-12-21-17-22(30)18-25(29)26(21)31/h7,11-12,16,19,22-25,30,32H,5-6,8-10,13-15,17-18H2,1-4H3/b16-7+,20-11+,21-12- |
| InChIKey | ZUTHAZSAQPHEKO-UQJKWSLQSA-N |
| XLogP | 6.25 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.65 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|