C12H26O3S2 — CID 90122482
2-(hydroxymethyl)-2-[4-methyl-1,7-bis(sulfanyl)heptan-4-yl]propane-1,3-diol (PubChem CID 90122482) has the molecular formula C12H26O3S2 and a molecular weight of 282.47 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-[4-methyl-1,7-bis(sulfanyl)heptan-4-yl]propane-1,3-diol.
| Compound Name | 2-(hydroxymethyl)-2-[4-methyl-1,7-bis(sulfanyl)heptan-4-yl]propane-1,3-diol |
|---|---|
| PubChem CID | 90122482 |
| Molecular Formula | C12H26O3S2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 2-(hydroxymethyl)-2-[4-methyl-1,7-bis(sulfanyl)heptan-4-yl]propane-1,3-diol |
| SMILES | CC(CCCS)(CCCS)C(CO)(CO)CO |
| InChI | InChI=1S/C12H26O3S2/c1-11(4-2-6-16,5-3-7-17)12(8-13,9-14)10-15/h13-17H,2-10H2,1H3 |
| InChIKey | WIDRRUDRYGUQRO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|