C36H45N7O11 — CID 90124002
[4-[[(2S)-1-amino-5-(carbamoylamino)-1-oxopentan-2-yl]-[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]phenyl]methyl (4-nitrophenyl)methyl carbonate (PubChem CID 90124002) has the molecular formula C36H45N7O11 and a molecular weight of 751.79 g/mol. Its IUPAC name is [4-[[(2S)-1-amino-5-(carbamoylamino)-1-oxopentan-2-yl]-[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]phenyl]methyl (4-nitrophenyl)methyl carbonate.
| Compound Name | [4-[[(2S)-1-amino-5-(carbamoylamino)-1-oxopentan-2-yl]-[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]phenyl]methyl (4-nitrophenyl)methyl carbonate |
|---|---|
| PubChem CID | 90124002 |
| Molecular Formula | C36H45N7O11 |
| Molecular Weight | 751.79 g/mol |
| Exact Mass | 751.32 |
| IUPAC Name | [4-[[(2S)-1-amino-5-(carbamoylamino)-1-oxopentan-2-yl]-[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]phenyl]methyl (4-nitrophenyl)methyl carbonate |
| SMILES | CC(C)[C@H](NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)N(c1ccc(COC(=O)OCc2ccc([N+](=O)[O-])cc2)cc1)[C@@H](CCCNC(N)=O)C(N)=O |
| InChI | InChI=1S/C36H45N7O11/c1-23(2)32(40-29(44)8-4-3-5-20-41-30(45)17-18-31(41)46)34(48)42(28(33(37)47)7-6-19-39-35(38)49)26-13-9-24(10-14-26)21-53-36(50)54-22-25-11-15-27(16-12-25)43(51)52/h9-18,23,28,32H,3-8,19-22H2,1-2H3,(H2,37,47)(H,40,44)(H3,38,39,49)/t28-,32-/m0/s1 |
| InChIKey | ODSAGEYQXWYQJO-IUDBTDONSA-N |
| XLogP | 2.71 |
| TPSA | 263.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.79 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|