C17H20N2O2S — CID 90126046
N-[2-[4-[amino(hydroxy)methyl]phenyl]ethyl]-2-phenylsulfanylacetamide (PubChem CID 90126046) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is N-[2-[4-[amino(hydroxy)methyl]phenyl]ethyl]-2-phenylsulfanylacetamide.
| Compound Name | N-[2-[4-[amino(hydroxy)methyl]phenyl]ethyl]-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 90126046 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-[2-[4-[amino(hydroxy)methyl]phenyl]ethyl]-2-phenylsulfanylacetamide |
| SMILES | NC(O)c1ccc(CCNC(=O)CSc2ccccc2)cc1 |
| InChI | InChI=1S/C17H20N2O2S/c18-17(21)14-8-6-13(7-9-14)10-11-19-16(20)12-22-15-4-2-1-3-5-15/h1-9,17,21H,10-12,18H2,(H,19,20) |
| InChIKey | LHEPNQQHSNLISK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|