C15H14BClN2O4S2 — CID 90127506
CID 90127506 (PubChem CID 90127506) has the molecular formula C15H14BClN2O4S2 and a molecular weight of 396.69 g/mol.
| Compound Name | CID 90127506 |
|---|---|
| PubChem CID | 90127506 |
| Molecular Formula | C15H14BClN2O4S2 |
| Molecular Weight | 396.69 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | — |
| SMILES | [B]OC(=O)C1C(CCl)=C(C)S[C@@H]2[C@H](NC(=O)Cc3cccs3)C(=O)N12 |
| InChI | InChI=1S/C15H14BClN2O4S2/c1-7-9(6-17)12(15(22)23-16)19-13(21)11(14(19)25-7)18-10(20)5-8-3-2-4-24-8/h2-4,11-12,14H,5-6H2,1H3,(H,18,20)/t11-,12?,14-/m1/s1 |
| InChIKey | OZEMSBZMINZELH-YXHCSQSYSA-N |
| XLogP | 1.20 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.69 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|