C6H9NS — CID 90127785
3,4,5,6-tetrahydro-1H-thieno[3,4-c]pyrrole (PubChem CID 90127785) has the molecular formula C6H9NS and a molecular weight of 127.21 g/mol. Its IUPAC name is 3,4,5,6-tetrahydro-1H-thieno[3,4-c]pyrrole.
| Compound Name | 3,4,5,6-tetrahydro-1H-thieno[3,4-c]pyrrole |
|---|---|
| PubChem CID | 90127785 |
| Molecular Formula | C6H9NS |
| Molecular Weight | 127.21 g/mol |
| Exact Mass | 127.05 |
| IUPAC Name | 3,4,5,6-tetrahydro-1H-thieno[3,4-c]pyrrole |
| SMILES | C1NCC2=C1CSC2 |
| InChI | InChI=1S/C6H9NS/c1-5-3-8-4-6(5)2-7-1/h7H,1-4H2 |
| InChIKey | KSFQWFIJHZHIPZ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.21 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|