C25H17BrN2 — CID 90130289
4-(N-(4-bromophenyl)-4-phenylanilino)benzonitrile (PubChem CID 90130289) has the molecular formula C25H17BrN2 and a molecular weight of 425.33 g/mol. Its IUPAC name is 4-(N-(4-bromophenyl)-4-phenylanilino)benzonitrile.
| Compound Name | 4-(N-(4-bromophenyl)-4-phenylanilino)benzonitrile |
|---|---|
| PubChem CID | 90130289 |
| Molecular Formula | C25H17BrN2 |
| Molecular Weight | 425.33 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 4-(N-(4-bromophenyl)-4-phenylanilino)benzonitrile |
| SMILES | N#Cc1ccc(N(c2ccc(Br)cc2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H17BrN2/c26-22-10-16-25(17-11-22)28(23-12-6-19(18-27)7-13-23)24-14-8-21(9-15-24)20-4-2-1-3-5-20/h1-17H |
| InChIKey | LNNCKYFKCNMRHH-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.33 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |