C25H28FN3O5S — CID 90130953
(1aR,7bS)-5-[[2-[2-[[(3R)-1-ethylpyrrolidin-3-yl]amino]-2-oxoethyl]-4-fluorophenyl]sulfinylamino]-1,1a,2,7b-tetrahydrocyclopropa[c]chromene-4-carboxylic acid (PubChem CID 90130953) has the molecular formula C25H28FN3O5S and a molecular weight of 501.58 g/mol. Its IUPAC name is (1aR,7bS)-5-[[2-[2-[[(3R)-1-ethylpyrrolidin-3-yl]amino]-2-oxoethyl]-4-fluorophenyl]sulfinylamino]-1,1a,2,7b-tetrahydrocyclopropa[c]chromene-4-carboxylic acid.
| Compound Name | (1aR,7bS)-5-[[2-[2-[[(3R)-1-ethylpyrrolidin-3-yl]amino]-2-oxoethyl]-4-fluorophenyl]sulfinylamino]-1,1a,2,7b-tetrahydrocyclopropa[c]chromene-4-carboxylic acid |
|---|---|
| PubChem CID | 90130953 |
| Molecular Formula | C25H28FN3O5S |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | (1aR,7bS)-5-[[2-[2-[[(3R)-1-ethylpyrrolidin-3-yl]amino]-2-oxoethyl]-4-fluorophenyl]sulfinylamino]-1,1a,2,7b-tetrahydrocyclopropa[c]chromene-4-carboxylic acid |
| SMILES | CCN1CC[C@@H](NC(=O)Cc2cc(F)ccc2S(=O)Nc2ccc3c(c2C(=O)O)OC[C@@H]2C[C@H]32)C1 |
| InChI | InChI=1S/C25H28FN3O5S/c1-2-29-8-7-17(12-29)27-22(30)11-14-9-16(26)3-6-21(14)35(33)28-20-5-4-18-19-10-15(19)13-34-24(18)23(20)25(31)32/h3-6,9,15,17,19,28H,2,7-8,10-13H2,1H3,(H,27,30)(H,31,32)/t15-,17+,19-,35?/m0/s1 |
| InChIKey | IWYBXWKVARPNBF-KSWLQEADSA-N |
| XLogP | 2.91 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |