C24H25FN2O3 — CID 90133065
(3S)-3-[4-[[3-fluoro-1-(2-methylpropyl)pyrrolo[2,3-b]pyridin-4-yl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 90133065) has the molecular formula C24H25FN2O3 and a molecular weight of 408.47 g/mol. Its IUPAC name is (3S)-3-[4-[[3-fluoro-1-(2-methylpropyl)pyrrolo[2,3-b]pyridin-4-yl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | (3S)-3-[4-[[3-fluoro-1-(2-methylpropyl)pyrrolo[2,3-b]pyridin-4-yl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 90133065 |
| Molecular Formula | C24H25FN2O3 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | (3S)-3-[4-[[3-fluoro-1-(2-methylpropyl)pyrrolo[2,3-b]pyridin-4-yl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(OCc2ccnc3c2c(F)cn3CC(C)C)cc1 |
| InChI | InChI=1S/C24H25FN2O3/c1-4-5-18(12-22(28)29)17-6-8-20(9-7-17)30-15-19-10-11-26-24-23(19)21(25)14-27(24)13-16(2)3/h6-11,14,16,18H,12-13,15H2,1-3H3,(H,28,29)/t18-/m0/s1 |
| InChIKey | XERASIVDBYNWNA-SFHVURJKSA-N |
| XLogP | 4.99 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|