C9H6F3N3O — CID 90133764
3-methyl-2-(trifluoromethyl)imidazo[1,2-b]pyridazine-6-carbaldehyde (PubChem CID 90133764) has the molecular formula C9H6F3N3O and a molecular weight of 229.16 g/mol. Its IUPAC name is 3-methyl-2-(trifluoromethyl)imidazo[1,2-b]pyridazine-6-carbaldehyde.
| Compound Name | 3-methyl-2-(trifluoromethyl)imidazo[1,2-b]pyridazine-6-carbaldehyde |
|---|---|
| PubChem CID | 90133764 |
| Molecular Formula | C9H6F3N3O |
| Molecular Weight | 229.16 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 3-methyl-2-(trifluoromethyl)imidazo[1,2-b]pyridazine-6-carbaldehyde |
| SMILES | Cc1c(C(F)(F)F)nc2ccc(C=O)nn12 |
| InChI | InChI=1S/C9H6F3N3O/c1-5-8(9(10,11)12)13-7-3-2-6(4-16)14-15(5)7/h2-4H,1H3 |
| InChIKey | RMTVHKBAIMICCH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.16 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|