C23H40O3 — CID 90137232
methyl 5-[(1Z,5R,6S)-5-hydroxy-7-methyl-6-[(E)-oct-1-enyl]cycloocten-1-yl]pentanoate (PubChem CID 90137232) has the molecular formula C23H40O3 and a molecular weight of 364.57 g/mol. Its IUPAC name is methyl 5-[(1Z,5R,6S)-5-hydroxy-7-methyl-6-[(E)-oct-1-enyl]cycloocten-1-yl]pentanoate.
| Compound Name | methyl 5-[(1Z,5R,6S)-5-hydroxy-7-methyl-6-[(E)-oct-1-enyl]cycloocten-1-yl]pentanoate |
|---|---|
| PubChem CID | 90137232 |
| Molecular Formula | C23H40O3 |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.30 |
| IUPAC Name | methyl 5-[(1Z,5R,6S)-5-hydroxy-7-methyl-6-[(E)-oct-1-enyl]cycloocten-1-yl]pentanoate |
| SMILES | CCCCCC/C=C/[C@@H]1C(C)C/C(CCCCC(=O)OC)=C\CC[C@H]1O |
| InChI | InChI=1S/C23H40O3/c1-4-5-6-7-8-9-15-21-19(2)18-20(14-12-16-22(21)24)13-10-11-17-23(25)26-3/h9,14-15,19,21-22,24H,4-8,10-13,16-18H2,1-3H3/b15-9+,20-14-/t19?,21-,22-/m1/s1 |
| InChIKey | OVIHXZWMMFNLNT-JOQMYLMNSA-N |
| XLogP | 5.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|