C30H35F3N2O6S — CID 90137554
tert-butyl (2S)-2-[[3-[7-(trifluoromethylsulfonyloxy)spiro[1,3-dihydroindene-2,1'-cyclopentane]-4-yl]phenyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 90137554) has the molecular formula C30H35F3N2O6S and a molecular weight of 608.68 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[3-[7-(trifluoromethylsulfonyloxy)spiro[1,3-dihydroindene-2,1'-cyclopentane]-4-yl]phenyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[3-[7-(trifluoromethylsulfonyloxy)spiro[1,3-dihydroindene-2,1'-cyclopentane]-4-yl]phenyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90137554 |
| Molecular Formula | C30H35F3N2O6S |
| Molecular Weight | 608.68 g/mol |
| Exact Mass | 608.22 |
| IUPAC Name | tert-butyl (2S)-2-[[3-[7-(trifluoromethylsulfonyloxy)spiro[1,3-dihydroindene-2,1'-cyclopentane]-4-yl]phenyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)Nc1cccc(-c2ccc(OS(=O)(=O)C(F)(F)F)c3c2CC2(CCCC2)C3)c1 |
| InChI | InChI=1S/C30H35F3N2O6S/c1-28(2,3)40-27(37)35-15-7-10-24(35)26(36)34-20-9-6-8-19(16-20)21-11-12-25(41-42(38,39)30(31,32)33)23-18-29(17-22(21)23)13-4-5-14-29/h6,8-9,11-12,16,24H,4-5,7,10,13-15,17-18H2,1-3H3,(H,34,36)/t24-/m0/s1 |
| InChIKey | LRLFBZNCIUTZDX-DEOSSOPVSA-N |
| XLogP | 6.58 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.68 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|