C18H9F2N3OS — CID 90137702
1-[(2-cyano-5-fluorophenyl)methylsulfanyl]-7-fluoro-3-oxo-2H-isoquinoline-4-carbonitrile (PubChem CID 90137702) has the molecular formula C18H9F2N3OS and a molecular weight of 353.35 g/mol. Its IUPAC name is 1-[(2-cyano-5-fluorophenyl)methylsulfanyl]-7-fluoro-3-oxo-2H-isoquinoline-4-carbonitrile.
| Compound Name | 1-[(2-cyano-5-fluorophenyl)methylsulfanyl]-7-fluoro-3-oxo-2H-isoquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 90137702 |
| Molecular Formula | C18H9F2N3OS |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 1-[(2-cyano-5-fluorophenyl)methylsulfanyl]-7-fluoro-3-oxo-2H-isoquinoline-4-carbonitrile |
| SMILES | N#Cc1ccc(F)cc1CSc1[nH]c(=O)c(C#N)c2ccc(F)cc12 |
| InChI | InChI=1S/C18H9F2N3OS/c19-12-2-1-10(7-21)11(5-12)9-25-18-15-6-13(20)3-4-14(15)16(8-22)17(24)23-18/h1-6H,9H2,(H,23,24) |
| InChIKey | AGLSQYHFAGQIDN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |