C17H22N2O3S2 — CID 90137728
1-(4-ethylthiophen-2-yl)-4-(4-methoxyphenyl)sulfonylpiperazine (PubChem CID 90137728) has the molecular formula C17H22N2O3S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 1-(4-ethylthiophen-2-yl)-4-(4-methoxyphenyl)sulfonylpiperazine.
| Compound Name | 1-(4-ethylthiophen-2-yl)-4-(4-methoxyphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 90137728 |
| Molecular Formula | C17H22N2O3S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 1-(4-ethylthiophen-2-yl)-4-(4-methoxyphenyl)sulfonylpiperazine |
| SMILES | CCc1csc(N2CCN(S(=O)(=O)c3ccc(OC)cc3)CC2)c1 |
| InChI | InChI=1S/C17H22N2O3S2/c1-3-14-12-17(23-13-14)18-8-10-19(11-9-18)24(20,21)16-6-4-15(22-2)5-7-16/h4-7,12-13H,3,8-11H2,1-2H3 |
| InChIKey | FROMJVFMYMYPHI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |