C20H31NO5 — CID 90141798
[(3R)-6-methyl-1-phenylheptan-3-yl] 3-hydroxy-2-(2-hydroxypropanoylamino)propanoate (PubChem CID 90141798) has the molecular formula C20H31NO5 and a molecular weight of 365.47 g/mol. Its IUPAC name is [(3R)-6-methyl-1-phenylheptan-3-yl] 3-hydroxy-2-(2-hydroxypropanoylamino)propanoate.
| Compound Name | [(3R)-6-methyl-1-phenylheptan-3-yl] 3-hydroxy-2-(2-hydroxypropanoylamino)propanoate |
|---|---|
| PubChem CID | 90141798 |
| Molecular Formula | C20H31NO5 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | [(3R)-6-methyl-1-phenylheptan-3-yl] 3-hydroxy-2-(2-hydroxypropanoylamino)propanoate |
| SMILES | CC(C)CC[C@H](CCc1ccccc1)OC(=O)C(CO)NC(=O)C(C)O |
| InChI | InChI=1S/C20H31NO5/c1-14(2)9-11-17(12-10-16-7-5-4-6-8-16)26-20(25)18(13-22)21-19(24)15(3)23/h4-8,14-15,17-18,22-23H,9-13H2,1-3H3,(H,21,24)/t15?,17-,18?/m1/s1 |
| InChIKey | UZDHINBQEKKBGE-IIIMJFFVSA-N |
| XLogP | 1.83 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |