C22H24N2O3 — CID 90143002
3-[4-[[1-(cyclopropylmethyl)indazol-4-yl]methoxy]phenyl]butanoic acid (PubChem CID 90143002) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 3-[4-[[1-(cyclopropylmethyl)indazol-4-yl]methoxy]phenyl]butanoic acid.
| Compound Name | 3-[4-[[1-(cyclopropylmethyl)indazol-4-yl]methoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 90143002 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 3-[4-[[1-(cyclopropylmethyl)indazol-4-yl]methoxy]phenyl]butanoic acid |
| SMILES | CC(CC(=O)O)c1ccc(OCc2cccc3c2cnn3CC2CC2)cc1 |
| InChI | InChI=1S/C22H24N2O3/c1-15(11-22(25)26)17-7-9-19(10-8-17)27-14-18-3-2-4-21-20(18)12-23-24(21)13-16-5-6-16/h2-4,7-10,12,15-16H,5-6,11,13-14H2,1H3,(H,25,26) |
| InChIKey | ONMWFJAUTIGGAF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |