C17H16BN3O5S2 — CID 90143885
CID 90143885 (PubChem CID 90143885) has the molecular formula C17H16BN3O5S2 and a molecular weight of 417.28 g/mol.
| Compound Name | CID 90143885 |
|---|---|
| PubChem CID | 90143885 |
| Molecular Formula | C17H16BN3O5S2 |
| Molecular Weight | 417.28 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | — |
| SMILES | [B]OC(=O)C1=C(CSc2ccncc2)CS[C@@H]2[C@H](NC(=O)OCC=C)C(=O)N12 |
| InChI | InChI=1S/C17H16BN3O5S2/c1-2-7-25-17(24)20-12-14(22)21-13(16(23)26-18)10(9-28-15(12)21)8-27-11-3-5-19-6-4-11/h2-6,12,15H,1,7-9H2,(H,20,24)/t12-,15-/m1/s1 |
| InChIKey | JZYCFIHUEWBJEH-IUODEOHRSA-N |
| XLogP | 1.25 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|