C21H32N4 — CID 90146384
N-(2-adamantyl)-N-methyl-4-(4-methylpiperazin-1-yl)pyridin-2-amine (PubChem CID 90146384) has the molecular formula C21H32N4 and a molecular weight of 340.52 g/mol. Its IUPAC name is N-(2-adamantyl)-N-methyl-4-(4-methylpiperazin-1-yl)pyridin-2-amine.
| Compound Name | N-(2-adamantyl)-N-methyl-4-(4-methylpiperazin-1-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 90146384 |
| Molecular Formula | C21H32N4 |
| Molecular Weight | 340.52 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | N-(2-adamantyl)-N-methyl-4-(4-methylpiperazin-1-yl)pyridin-2-amine |
| SMILES | CN1CCN(c2ccnc(N(C)C3C4CC5CC(C4)CC3C5)c2)CC1 |
| InChI | InChI=1S/C21H32N4/c1-23-5-7-25(8-6-23)19-3-4-22-20(14-19)24(2)21-17-10-15-9-16(12-17)13-18(21)11-15/h3-4,14-18,21H,5-13H2,1-2H3 |
| InChIKey | PQQBICMCBGQCDJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |