C30H24F3N5O3S — CID 90149449
N-[6-[1-(3-phenylmethoxypropyl)-2-[3-(trifluoromethyl)benzoyl]imidazol-4-yl]-3-pyridinyl]-1,3-thiazole-4-carboxamide (PubChem CID 90149449) has the molecular formula C30H24F3N5O3S and a molecular weight of 591.62 g/mol. Its IUPAC name is N-[6-[1-(3-phenylmethoxypropyl)-2-[3-(trifluoromethyl)benzoyl]imidazol-4-yl]-3-pyridinyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[6-[1-(3-phenylmethoxypropyl)-2-[3-(trifluoromethyl)benzoyl]imidazol-4-yl]-3-pyridinyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 90149449 |
| Molecular Formula | C30H24F3N5O3S |
| Molecular Weight | 591.62 g/mol |
| Exact Mass | 591.16 |
| IUPAC Name | N-[6-[1-(3-phenylmethoxypropyl)-2-[3-(trifluoromethyl)benzoyl]imidazol-4-yl]-3-pyridinyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(-c2cn(CCCOCc3ccccc3)c(C(=O)c3cccc(C(F)(F)F)c3)n2)nc1)c1cscn1 |
| InChI | InChI=1S/C30H24F3N5O3S/c31-30(32,33)22-9-4-8-21(14-22)27(39)28-37-25(16-38(28)12-5-13-41-17-20-6-2-1-3-7-20)24-11-10-23(15-34-24)36-29(40)26-18-42-19-35-26/h1-4,6-11,14-16,18-19H,5,12-13,17H2,(H,36,40) |
| InChIKey | QKSRPIBYONEUBG-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.62 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|