C31H26F3N5O3S — CID 118494569
N-[4-[2-[[4-phenylmethoxy-2-[3-(trifluoromethyl)phenyl]butanoyl]amino]-1H-imidazol-5-yl]phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 118494569) has the molecular formula C31H26F3N5O3S and a molecular weight of 605.64 g/mol. Its IUPAC name is N-[4-[2-[[4-phenylmethoxy-2-[3-(trifluoromethyl)phenyl]butanoyl]amino]-1H-imidazol-5-yl]phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-[2-[[4-phenylmethoxy-2-[3-(trifluoromethyl)phenyl]butanoyl]amino]-1H-imidazol-5-yl]phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 118494569 |
| Molecular Formula | C31H26F3N5O3S |
| Molecular Weight | 605.64 g/mol |
| Exact Mass | 605.17 |
| IUPAC Name | N-[4-[2-[[4-phenylmethoxy-2-[3-(trifluoromethyl)phenyl]butanoyl]amino]-1H-imidazol-5-yl]phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(-c2cnc(NC(=O)C(CCOCc3ccccc3)c3cccc(C(F)(F)F)c3)[nH]2)cc1)c1cscn1 |
| InChI | InChI=1S/C31H26F3N5O3S/c32-31(33,34)23-8-4-7-22(15-23)25(13-14-42-17-20-5-2-1-3-6-20)28(40)39-30-35-16-26(38-30)21-9-11-24(12-10-21)37-29(41)27-18-43-19-36-27/h1-12,15-16,18-19,25H,13-14,17H2,(H,37,41)(H2,35,38,39,40) |
| InChIKey | NOSWLVJNIXDDCJ-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.64 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|