C20H16N4OS — CID 90149631
N-[4-(5-anilino-1H-pyrrol-2-yl)phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 90149631) has the molecular formula C20H16N4OS and a molecular weight of 360.44 g/mol. Its IUPAC name is N-[4-(5-anilino-1H-pyrrol-2-yl)phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-(5-anilino-1H-pyrrol-2-yl)phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 90149631 |
| Molecular Formula | C20H16N4OS |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | N-[4-(5-anilino-1H-pyrrol-2-yl)phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(-c2ccc(Nc3ccccc3)[nH]2)cc1)c1cscn1 |
| InChI | InChI=1S/C20H16N4OS/c25-20(18-12-26-13-21-18)23-16-8-6-14(7-9-16)17-10-11-19(24-17)22-15-4-2-1-3-5-15/h1-13,22,24H,(H,23,25) |
| InChIKey | UBBJXKMWFGNARE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |