C17H20N2O4 — CID 90149697
tert-butyl N-[(2R,3R)-2-(hydroxymethyl)-11-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-yl]carbamate (PubChem CID 90149697) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R)-2-(hydroxymethyl)-11-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R)-2-(hydroxymethyl)-11-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-yl]carbamate |
|---|---|
| PubChem CID | 90149697 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | tert-butyl N-[(2R,3R)-2-(hydroxymethyl)-11-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1c2cccc3ccc(=O)n(c23)[C@H]1CO |
| InChI | InChI=1S/C17H20N2O4/c1-17(2,3)23-16(22)18-14-11-6-4-5-10-7-8-13(21)19(15(10)11)12(14)9-20/h4-8,12,14,20H,9H2,1-3H3,(H,18,22)/t12-,14+/m0/s1 |
| InChIKey | WSMCLISRVJADRY-GXTWGEPZSA-N |
| XLogP | 2.11 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |