C14H19ClN2O3 — CID 177204659
tert-butyl N-[(5R,6S)-2-chloro-6-hydroxy-5,6,7,8-tetrahydroquinolin-5-yl]carbamate (PubChem CID 177204659) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is tert-butyl N-[(5R,6S)-2-chloro-6-hydroxy-5,6,7,8-tetrahydroquinolin-5-yl]carbamate.
| Compound Name | tert-butyl N-[(5R,6S)-2-chloro-6-hydroxy-5,6,7,8-tetrahydroquinolin-5-yl]carbamate |
|---|---|
| PubChem CID | 177204659 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | tert-butyl N-[(5R,6S)-2-chloro-6-hydroxy-5,6,7,8-tetrahydroquinolin-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1c2ccc(Cl)nc2CC[C@@H]1O |
| InChI | InChI=1S/C14H19ClN2O3/c1-14(2,3)20-13(19)17-12-8-4-7-11(15)16-9(8)5-6-10(12)18/h4,7,10,12,18H,5-6H2,1-3H3,(H,17,19)/t10-,12+/m0/s1 |
| InChIKey | QKHZBLBEBOLERS-CMPLNLGQSA-N |
| XLogP | 2.61 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|