C18H29ClN2O4 — CID 177205552
tert-butyl N-(3-chloro-7-propoxy-5,6,7,8-tetrahydroisoquinolin-8-yl)carbamate;methanol (PubChem CID 177205552) has the molecular formula C18H29ClN2O4 and a molecular weight of 372.89 g/mol. Its IUPAC name is tert-butyl N-(3-chloro-7-propoxy-5,6,7,8-tetrahydroisoquinolin-8-yl)carbamate;methanol.
| Compound Name | tert-butyl N-(3-chloro-7-propoxy-5,6,7,8-tetrahydroisoquinolin-8-yl)carbamate;methanol |
|---|---|
| PubChem CID | 177205552 |
| Molecular Formula | C18H29ClN2O4 |
| Molecular Weight | 372.89 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | tert-butyl N-(3-chloro-7-propoxy-5,6,7,8-tetrahydroisoquinolin-8-yl)carbamate;methanol |
| SMILES | CCCOC1CCc2cc(Cl)ncc2C1NC(=O)OC(C)(C)C.CO |
| InChI | InChI=1S/C17H25ClN2O3.CH4O/c1-5-8-22-13-7-6-11-9-14(18)19-10-12(11)15(13)20-16(21)23-17(2,3)4;1-2/h9-10,13,15H,5-8H2,1-4H3,(H,20,21);2H,1H3 |
| InChIKey | UVNGBEKAHLXIKD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.89 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|