C14H16ClF3N2O2 — CID 129078757
tert-butyl N-[2-chloro-4-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-5-yl]carbamate (PubChem CID 129078757) has the molecular formula C14H16ClF3N2O2 and a molecular weight of 336.74 g/mol. Its IUPAC name is tert-butyl N-[2-chloro-4-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-5-yl]carbamate.
| Compound Name | tert-butyl N-[2-chloro-4-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-5-yl]carbamate |
|---|---|
| PubChem CID | 129078757 |
| Molecular Formula | C14H16ClF3N2O2 |
| Molecular Weight | 336.74 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | tert-butyl N-[2-chloro-4-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCc2nc(Cl)cc(C(F)(F)F)c21 |
| InChI | InChI=1S/C14H16ClF3N2O2/c1-13(2,3)22-12(21)20-9-5-4-8-11(9)7(14(16,17)18)6-10(15)19-8/h6,9H,4-5H2,1-3H3,(H,20,21) |
| InChIKey | XYCIUJOLKKGFDW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.74 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|