C32H41ClN2O4Si — CID 177204753
tert-butyl N-[(5S,6S)-6-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridin-5-yl]carbamate (PubChem CID 177204753) has the molecular formula C32H41ClN2O4Si and a molecular weight of 581.23 g/mol. Its IUPAC name is tert-butyl N-[(5S,6S)-6-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridin-5-yl]carbamate.
| Compound Name | tert-butyl N-[(5S,6S)-6-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridin-5-yl]carbamate |
|---|---|
| PubChem CID | 177204753 |
| Molecular Formula | C32H41ClN2O4Si |
| Molecular Weight | 581.23 g/mol |
| Exact Mass | 580.25 |
| IUPAC Name | tert-butyl N-[(5S,6S)-6-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridin-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1c2ccc(Cl)nc2CO[C@H]1CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H41ClN2O4Si/c1-31(2,3)39-30(36)35-29-25-19-20-28(33)34-26(25)22-37-27(29)18-13-21-38-40(32(4,5)6,23-14-9-7-10-15-23)24-16-11-8-12-17-24/h7-12,14-17,19-20,27,29H,13,18,21-22H2,1-6H3,(H,35,36)/t27-,29-/m0/s1 |
| InChIKey | RQFXLMARIPVIFD-YTMVLYRLSA-N |
| XLogP | 6.56 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.23 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|