C33H42ClNO4Si — CID 177204745
tert-butyl N-[(3S,4S)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-7-chloro-3,4-dihydro-1H-isochromen-4-yl]carbamate (PubChem CID 177204745) has the molecular formula C33H42ClNO4Si and a molecular weight of 580.24 g/mol. Its IUPAC name is tert-butyl N-[(3S,4S)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-7-chloro-3,4-dihydro-1H-isochromen-4-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4S)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-7-chloro-3,4-dihydro-1H-isochromen-4-yl]carbamate |
|---|---|
| PubChem CID | 177204745 |
| Molecular Formula | C33H42ClNO4Si |
| Molecular Weight | 580.24 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | tert-butyl N-[(3S,4S)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-7-chloro-3,4-dihydro-1H-isochromen-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1c2ccc(Cl)cc2CO[C@H]1CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H42ClNO4Si/c1-32(2,3)39-31(36)35-30-28-20-19-25(34)22-24(28)23-37-29(30)18-13-21-38-40(33(4,5)6,26-14-9-7-10-15-26)27-16-11-8-12-17-27/h7-12,14-17,19-20,22,29-30H,13,18,21,23H2,1-6H3,(H,35,36)/t29-,30-/m0/s1 |
| InChIKey | GVMQSPOXNNAFNE-KYJUHHDHSA-N |
| XLogP | 7.16 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.24 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|