C32H39F3N2O4Si — CID 177205489
tert-butyl N-[(2S,3S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-6-(trifluoromethyl)-2,3-dihydrofuro[2,3-b]pyridin-3-yl]carbamate (PubChem CID 177205489) has the molecular formula C32H39F3N2O4Si and a molecular weight of 600.75 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-6-(trifluoromethyl)-2,3-dihydrofuro[2,3-b]pyridin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-6-(trifluoromethyl)-2,3-dihydrofuro[2,3-b]pyridin-3-yl]carbamate |
|---|---|
| PubChem CID | 177205489 |
| Molecular Formula | C32H39F3N2O4Si |
| Molecular Weight | 600.75 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | tert-butyl N-[(2S,3S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-6-(trifluoromethyl)-2,3-dihydrofuro[2,3-b]pyridin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1c2ccc(C(F)(F)F)nc2O[C@H]1CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H39F3N2O4Si/c1-30(2,3)41-29(38)37-27-24-19-20-26(32(33,34)35)36-28(24)40-25(27)18-13-21-39-42(31(4,5)6,22-14-9-7-10-15-22)23-16-11-8-12-17-23/h7-12,14-17,19-20,25,27H,13,18,21H2,1-6H3,(H,37,38)/t25-,27-/m0/s1 |
| InChIKey | LWPYPUXNVCBYFT-BDYUSTAISA-N |
| XLogP | 6.78 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.75 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|