C20H14ClN3O2 — CID 90152581
5-chloro-2-[(1-pyridin-3-ylindol-5-yl)amino]benzoic acid (PubChem CID 90152581) has the molecular formula C20H14ClN3O2 and a molecular weight of 363.80 g/mol. Its IUPAC name is 5-chloro-2-[(1-pyridin-3-ylindol-5-yl)amino]benzoic acid.
| Compound Name | 5-chloro-2-[(1-pyridin-3-ylindol-5-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 90152581 |
| Molecular Formula | C20H14ClN3O2 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 5-chloro-2-[(1-pyridin-3-ylindol-5-yl)amino]benzoic acid |
| SMILES | O=C(O)c1cc(Cl)ccc1Nc1ccc2c(ccn2-c2cccnc2)c1 |
| InChI | InChI=1S/C20H14ClN3O2/c21-14-3-5-18(17(11-14)20(25)26)23-15-4-6-19-13(10-15)7-9-24(19)16-2-1-8-22-12-16/h1-12,23H,(H,25,26) |
| InChIKey | CZKOSDSZNHXOBU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |