C19H17ClN2O2 — CID 90152599
5-chloro-2-[[1-(cyclopropylmethyl)indol-5-yl]amino]benzoic acid (PubChem CID 90152599) has the molecular formula C19H17ClN2O2 and a molecular weight of 340.81 g/mol. Its IUPAC name is 5-chloro-2-[[1-(cyclopropylmethyl)indol-5-yl]amino]benzoic acid.
| Compound Name | 5-chloro-2-[[1-(cyclopropylmethyl)indol-5-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 90152599 |
| Molecular Formula | C19H17ClN2O2 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 5-chloro-2-[[1-(cyclopropylmethyl)indol-5-yl]amino]benzoic acid |
| SMILES | O=C(O)c1cc(Cl)ccc1Nc1ccc2c(ccn2CC2CC2)c1 |
| InChI | InChI=1S/C19H17ClN2O2/c20-14-3-5-17(16(10-14)19(23)24)21-15-4-6-18-13(9-15)7-8-22(18)11-12-1-2-12/h3-10,12,21H,1-2,11H2,(H,23,24) |
| InChIKey | ZPNWNUCJDFQWRD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |