C24H19F3N2O2 — CID 90152875
methyl 2-[(1-benzylindol-5-yl)amino]-5-(trifluoromethyl)benzoate (PubChem CID 90152875) has the molecular formula C24H19F3N2O2 and a molecular weight of 424.42 g/mol. Its IUPAC name is methyl 2-[(1-benzylindol-5-yl)amino]-5-(trifluoromethyl)benzoate.
| Compound Name | methyl 2-[(1-benzylindol-5-yl)amino]-5-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 90152875 |
| Molecular Formula | C24H19F3N2O2 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | methyl 2-[(1-benzylindol-5-yl)amino]-5-(trifluoromethyl)benzoate |
| SMILES | COC(=O)c1cc(C(F)(F)F)ccc1Nc1ccc2c(ccn2Cc2ccccc2)c1 |
| InChI | InChI=1S/C24H19F3N2O2/c1-31-23(30)20-14-18(24(25,26)27)7-9-21(20)28-19-8-10-22-17(13-19)11-12-29(22)15-16-5-3-2-4-6-16/h2-14,28H,15H2,1H3 |
| InChIKey | PKKGNKGOJJZPAQ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |